C25H22N6O3S2 — CID 123290864
N-[2-[(4aR,6S,8aR)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyanopyridine-2-carboxamide (PubChem CID 123290864) has the molecular formula C25H22N6O3S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is N-[2-[(4aR,6S,8aR)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyanopyridine-2-carboxamide.
| Compound Name | N-[2-[(4aR,6S,8aR)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 123290864 |
| Molecular Formula | C25H22N6O3S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[2-[(4aR,6S,8aR)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyanopyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2csc([C@]34CO[C@@H](C)C[C@H]3CSC(NC(=O)c3ccccc3)=N4)n2)nc1 |
| InChI | InChI=1S/C25H22N6O3S2/c1-15-10-17-12-36-24(30-21(32)16-6-4-3-5-7-16)31-25(17,14-34-15)23-29-20(13-35-23)28-22(33)19-9-8-18(26-2)11-27-19/h3-9,11,13,15,17H,10,12,14H2,1H3,(H,28,33)(H,30,31,32)/t15-,17-,25-/m0/s1 |
| InChIKey | HDHVTTFKTKKRJI-RTNKVPBISA-N |
| XLogP | 4.49 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|