C23H22F2N6O3S2 — CID 118435577
N-[2-[(4aR,6S)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 118435577) has the molecular formula C23H22F2N6O3S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-[2-[(4aR,6S)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-[(4aR,6S)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118435577 |
| Molecular Formula | C23H22F2N6O3S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | N-[2-[(4aR,6S)-2-benzamido-6-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl]-1,3-thiazol-4-yl]-1-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | C[C@H]1C[C@H]2CSC(NC(=O)c3ccccc3)=NC2(c2nc(NC(=O)c3ccn(C(F)F)n3)cs2)CO1 |
| InChI | InChI=1S/C23H22F2N6O3S2/c1-13-9-15-10-36-22(28-18(32)14-5-3-2-4-6-14)29-23(15,12-34-13)20-27-17(11-35-20)26-19(33)16-7-8-31(30-16)21(24)25/h2-8,11,13,15,21H,9-10,12H2,1H3,(H,26,33)(H,28,29,32)/t13-,15-,23?/m0/s1 |
| InChIKey | AVLYAPGHFXDKHL-QIBYPSQBSA-N |
| XLogP | 4.14 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |