C10H20N4 — CID 123291204
2-(1,3-dimethyl-4-propan-2-ylpyrazol-5-yl)-1,1-dimethylhydrazine (PubChem CID 123291204) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-(1,3-dimethyl-4-propan-2-ylpyrazol-5-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(1,3-dimethyl-4-propan-2-ylpyrazol-5-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 123291204 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-(1,3-dimethyl-4-propan-2-ylpyrazol-5-yl)-1,1-dimethylhydrazine |
| SMILES | Cc1nn(C)c(NN(C)C)c1C(C)C |
| InChI | InChI=1S/C10H20N4/c1-7(2)9-8(3)11-14(6)10(9)12-13(4)5/h7,12H,1-6H3 |
| InChIKey | TXZOOTFKQIPZCR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|