C13H19N2O8P — CID 123292753
1-(3-hydroxy-6-oxo-6-propan-2-yloxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl)pyrimidine-2,4-dione (PubChem CID 123292753) has the molecular formula C13H19N2O8P and a molecular weight of 362.28 g/mol. Its IUPAC name is 1-(3-hydroxy-6-oxo-6-propan-2-yloxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(3-hydroxy-6-oxo-6-propan-2-yloxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123292753 |
| Molecular Formula | C13H19N2O8P |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-(3-hydroxy-6-oxo-6-propan-2-yloxy-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-2-yl)pyrimidine-2,4-dione |
| SMILES | CC(C)OP1(=O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2CO1 |
| InChI | InChI=1S/C13H19N2O8P/c1-7(2)23-24(19)20-5-8-9(6-21-24)22-12(11(8)17)15-4-3-10(16)14-13(15)18/h3-4,7-9,11-12,17H,5-6H2,1-2H3,(H,14,16,18) |
| InChIKey | MTWVWQFGYXIPIA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|