C17H26N3O9P — CID 123672974
butyl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate (PubChem CID 123672974) has the molecular formula C17H26N3O9P and a molecular weight of 447.38 g/mol. Its IUPAC name is butyl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate.
| Compound Name | butyl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate |
|---|---|
| PubChem CID | 123672974 |
| Molecular Formula | C17H26N3O9P |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | butyl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate |
| SMILES | CCCCOC(=O)C(C)NP1(=O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2CO1 |
| InChI | InChI=1S/C17H26N3O9P/c1-3-4-7-26-16(23)10(2)19-30(25)27-8-11-12(9-28-30)29-15(14(11)22)20-6-5-13(21)18-17(20)24/h5-6,10-12,14-15,22H,3-4,7-9H2,1-2H3,(H,19,25)(H,18,21,24) |
| InChIKey | OCTJCYTTYRMCKY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|