C14H19N6O8P — CID 90300318
methyl (2R)-2-[[(4aR,7R,7aS)-7-azido-6-(2,4-dioxopyrimidin-1-yl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate (PubChem CID 90300318) has the molecular formula C14H19N6O8P and a molecular weight of 430.31 g/mol. Its IUPAC name is methyl (2R)-2-[[(4aR,7R,7aS)-7-azido-6-(2,4-dioxopyrimidin-1-yl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(4aR,7R,7aS)-7-azido-6-(2,4-dioxopyrimidin-1-yl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 90300318 |
| Molecular Formula | C14H19N6O8P |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | methyl (2R)-2-[[(4aR,7R,7aS)-7-azido-6-(2,4-dioxopyrimidin-1-yl)-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NP1(=O)OC[C@H]2OC(n3ccc(=O)[nH]c3=O)[C@](C)(N=[N+]=[N-])[C@@H]2O1 |
| InChI | InChI=1S/C14H19N6O8P/c1-7(11(22)25-3)17-29(24)26-6-8-10(28-29)14(2,18-19-15)12(27-8)20-5-4-9(21)16-13(20)23/h4-5,7-8,10,12H,6H2,1-3H3,(H,17,24)(H,16,21,23)/t7-,8-,10-,12?,14-,29?/m1/s1 |
| InChIKey | ZHDXMSIAXLCMBX-YZTRPGLKSA-N |
| XLogP | 0.18 |
| TPSA | 186.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|