C16H24N3O9P — CID 123855042
propan-2-yl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate (PubChem CID 123855042) has the molecular formula C16H24N3O9P and a molecular weight of 433.35 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate |
|---|---|
| PubChem CID | 123855042 |
| Molecular Formula | C16H24N3O9P |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | propan-2-yl 2-[[2-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-6-oxo-2,3,3a,4,8,8a-hexahydrofuro[2,3-e][1,3,2]dioxaphosphepin-6-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP1(=O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2CO1 |
| InChI | InChI=1S/C16H24N3O9P/c1-8(2)27-15(22)9(3)18-29(24)25-6-10-11(7-26-29)28-14(13(10)21)19-5-4-12(20)17-16(19)23/h4-5,8-11,13-14,21H,6-7H2,1-3H3,(H,18,24)(H,17,20,23) |
| InChIKey | KIAGUEZDVLJFLI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|