C14H19N2O8P — CID 122537964
1-[(4aR,6R,7R,7aS)-4a-ethenyl-7-hydroxy-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione (PubChem CID 122537964) has the molecular formula C14H19N2O8P and a molecular weight of 374.29 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aS)-4a-ethenyl-7-hydroxy-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7R,7aS)-4a-ethenyl-7-hydroxy-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122537964 |
| Molecular Formula | C14H19N2O8P |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-[(4aR,6R,7R,7aS)-4a-ethenyl-7-hydroxy-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
| SMILES | C=C[C@@]12COP(=O)(OC(C)C)O[C@H]1[C@@H](O)[C@H](n1ccc(=O)[nH]c1=O)O2 |
| InChI | InChI=1S/C14H19N2O8P/c1-4-14-7-21-25(20,23-8(2)3)24-11(14)10(18)12(22-14)16-6-5-9(17)15-13(16)19/h4-6,8,10-12,18H,1,7H2,2-3H3,(H,15,17,19)/t10-,11+,12-,14-,25?/m1/s1 |
| InChIKey | VQPIGAPXIUDIRQ-SRGUKHSSSA-N |
| XLogP | 0.30 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|