C13H16F3N2O6PS — CID 123981279
1-[4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione (PubChem CID 123981279) has the molecular formula C13H16F3N2O6PS and a molecular weight of 416.31 g/mol. Its IUPAC name is 1-[4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123981279 |
| Molecular Formula | C13H16F3N2O6PS |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-[4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)OP1(=S)OCC2(C(F)F)OC(n3ccc(=O)[nH]c3=O)C(F)C2O1 |
| InChI | InChI=1S/C13H16F3N2O6PS/c1-6(2)23-25(26)21-5-13(11(15)16)9(24-25)8(14)10(22-13)18-4-3-7(19)17-12(18)20/h3-4,6,8-11H,5H2,1-2H3,(H,17,19,20) |
| InChIKey | HQCGDLLADNSOCC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|