C13H16F4N3O5PS — CID 118299628
1-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-fluoropyrimidin-2-one (PubChem CID 118299628) has the molecular formula C13H16F4N3O5PS and a molecular weight of 433.32 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-fluoropyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 118299628 |
| Molecular Formula | C13H16F4N3O5PS |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-fluoropyrimidin-2-one |
| SMILES | CC(C)OP1(=S)OC[C@@]2(C(F)F)O[C@@H](n3cc(F)c(N)nc3=O)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C13H16F4N3O5PS/c1-5(2)24-26(27)22-4-13(11(16)17)8(25-26)7(15)10(23-13)20-3-6(14)9(18)19-12(20)21/h3,5,7-8,10-11H,4H2,1-2H3,(H2,18,19,21)/t7-,8+,10-,13-,26?/m1/s1 |
| InChIKey | VMZWITVNKPQGOS-BVQJEURYSA-N |
| XLogP | 1.90 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|