C13H19ClF2N3O5P — CID 171568296
[(2S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphite (PubChem CID 171568296) has the molecular formula C13H19ClF2N3O5P and a molecular weight of 401.73 g/mol. Its IUPAC name is [(2S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphite.
| Compound Name | [(2S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphite |
|---|---|
| PubChem CID | 171568296 |
| Molecular Formula | C13H19ClF2N3O5P |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [(2S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-2-(chloromethyl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphite |
| SMILES | CC(C)OP(O)OC[C@]1(CCl)CC(F)C(n2cc(F)c(N)nc2=O)O1 |
| InChI | InChI=1S/C13H19ClF2N3O5P/c1-7(2)24-25(21)22-6-13(5-14)3-8(15)11(23-13)19-4-9(16)10(17)18-12(19)20/h4,7-8,11,21H,3,5-6H2,1-2H3,(H2,17,18,20)/t8?,11?,13-,25?/m1/s1 |
| InChIKey | WZMUOSISZJKTOF-WELUNUEGSA-N |
| XLogP | 1.86 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|