C13H16ClF3N3O6P — CID 123874285
1-[4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-chloropyrimidin-2-one (PubChem CID 123874285) has the molecular formula C13H16ClF3N3O6P and a molecular weight of 433.71 g/mol. Its IUPAC name is 1-[4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-chloropyrimidin-2-one.
| Compound Name | 1-[4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-chloropyrimidin-2-one |
|---|---|
| PubChem CID | 123874285 |
| Molecular Formula | C13H16ClF3N3O6P |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 1-[4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-amino-5-chloropyrimidin-2-one |
| SMILES | CC(C)OP1(=O)OCC2(C(F)F)OC(n3cc(Cl)c(N)nc3=O)C(F)C2O1 |
| InChI | InChI=1S/C13H16ClF3N3O6P/c1-5(2)25-27(22)23-4-13(11(16)17)8(26-27)7(15)10(24-13)20-3-6(14)9(18)19-12(20)21/h3,5,7-8,10-11H,4H2,1-2H3,(H2,18,19,21) |
| InChIKey | CVUCFQPSUCJMFI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|