C13H15F4N2O7P — CID 171568374
1-[(4aR,7aR)-4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 171568374) has the molecular formula C13H15F4N2O7P and a molecular weight of 418.24 g/mol. Its IUPAC name is 1-[(4aR,7aR)-4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,7aR)-4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171568374 |
| Molecular Formula | C13H15F4N2O7P |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-[(4aR,7aR)-4a-(difluoromethyl)-7-fluoro-2-oxo-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC(C)OP1(=O)OC[C@@]2(C(F)F)OC(n3cc(F)c(=O)[nH]c3=O)C(F)[C@@H]2O1 |
| InChI | InChI=1S/C13H15F4N2O7P/c1-5(2)25-27(22)23-4-13(11(16)17)8(26-27)7(15)10(24-13)19-3-6(14)9(20)18-12(19)21/h3,5,7-8,10-11H,4H2,1-2H3,(H,18,20,21)/t7?,8-,10?,13+,27?/m0/s1 |
| InChIKey | NKEXOQANPJOABD-IDESDCPMSA-N |
| XLogP | 1.50 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|