C12H14ClF2N2O6PS — CID 118125971
1-[(4aR,6R,7S,7aR)-7-chloro-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 118125971) has the molecular formula C12H14ClF2N2O6PS and a molecular weight of 418.74 g/mol. Its IUPAC name is 1-[(4aR,6R,7S,7aR)-7-chloro-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7S,7aR)-7-chloro-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118125971 |
| Molecular Formula | C12H14ClF2N2O6PS |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 1-[(4aR,6R,7S,7aR)-7-chloro-7-fluoro-2-propan-2-yloxy-2-sulfanylidene-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC(C)OP1(=S)OC[C@H]2O[C@@H](n3cc(F)c(=O)[nH]c3=O)[C@@](F)(Cl)[C@@H]2O1 |
| InChI | InChI=1S/C12H14ClF2N2O6PS/c1-5(2)22-24(25)20-4-7-8(23-24)12(13,15)10(21-7)17-3-6(14)9(18)16-11(17)19/h3,5,7-8,10H,4H2,1-2H3,(H,16,18,19)/t7-,8-,10-,12-,24?/m1/s1 |
| InChIKey | PAKRYCFXZXHTDY-CRFKIBNWSA-N |
| XLogP | 1.54 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|