C14H15ClF4NO6PS — CID 160911629
1-[(4aR,6R,7aR)-4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-chloropyridine-2,4-dione (PubChem CID 160911629) has the molecular formula C14H15ClF4NO6PS and a molecular weight of 467.76 g/mol. Its IUPAC name is 1-[(4aR,6R,7aR)-4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-chloropyridine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aR)-4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-chloropyridine-2,4-dione |
|---|---|
| PubChem CID | 160911629 |
| Molecular Formula | C14H15ClF4NO6PS |
| Molecular Weight | 467.76 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 1-[(4aR,6R,7aR)-4a-(difluoromethyl)-7,7-difluoro-2-propan-2-yloxy-2-sulfanylidene-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-5-chloropyridine-2,4-dione |
| SMILES | CC(C)OP1(=S)OC[C@@]2(C(F)F)O[C@@H](N3C=C(Cl)C(=O)CC3=O)C(F)(F)[C@@H]2O1 |
| InChI | InChI=1S/C14H15ClF4NO6PS/c1-6(2)25-27(28)23-5-13(11(16)17)10(26-27)14(18,19)12(24-13)20-4-7(15)8(21)3-9(20)22/h4,6,10-12H,3,5H2,1-2H3/t10-,12-,13-,27?/m1/s1 |
| InChIKey | SQWBXYWGEAHFNG-HWMVBJAISA-N |
| XLogP | 2.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|