C12H17N — CID 123294073
6-ethyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine (PubChem CID 123294073) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 6-ethyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine.
| Compound Name | 6-ethyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 123294073 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 6-ethyl-3,4,6,7-tetrahydro-2H-cyclohepta[b]pyridine |
| SMILES | CCC1C=C2CCCN=C2C=CC1 |
| InChI | InChI=1S/C12H17N/c1-2-10-5-3-7-12-11(9-10)6-4-8-13-12/h3,7,9-10H,2,4-6,8H2,1H3 |
| InChIKey | DFFKXQMIQXBTMB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |