C21H15BrN3O9P2- — CID 123295437
[[2-[5-bromo-3-[(Z)-2-(5-cyano-2-methoxyphenyl)-1-isocyanoethenyl]indol-1-yl]-2-oxoethoxy]-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 123295437) has the molecular formula C21H15BrN3O9P2- and a molecular weight of 595.22 g/mol. Its IUPAC name is [[2-[5-bromo-3-[(Z)-2-(5-cyano-2-methoxyphenyl)-1-isocyanoethenyl]indol-1-yl]-2-oxoethoxy]-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[2-[5-bromo-3-[(Z)-2-(5-cyano-2-methoxyphenyl)-1-isocyanoethenyl]indol-1-yl]-2-oxoethoxy]-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 123295437 |
| Molecular Formula | C21H15BrN3O9P2- |
| Molecular Weight | 595.22 g/mol |
| Exact Mass | 593.95 |
| IUPAC Name | [[2-[5-bromo-3-[(Z)-2-(5-cyano-2-methoxyphenyl)-1-isocyanoethenyl]indol-1-yl]-2-oxoethoxy]-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | [C-]#[N+]/C(=C\c1cc(C#N)ccc1OC)c1cn(C(=O)COP(=O)(O)OP(=O)([O-])O)c2ccc(Br)cc12 |
| InChI | InChI=1S/C21H16BrN3O9P2/c1-24-18(8-14-7-13(10-23)3-6-20(14)32-2)17-11-25(19-5-4-15(22)9-16(17)19)21(26)12-33-36(30,31)34-35(27,28)29/h3-9,11H,12H2,2H3,(H,30,31)(H2,27,28,29)/p-1/b18-8- |
| InChIKey | RVQADICZOMUVJF-LSCVHKIXSA-M |
| XLogP | 3.94 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|