C24H20BrN3O2 — CID 123697082
3-[2-[5-bromo-1-(2,2-dimethylpropanoyl)indol-3-yl]-2-cyanoethenyl]-4-methoxybenzonitrile (PubChem CID 123697082) has the molecular formula C24H20BrN3O2 and a molecular weight of 462.35 g/mol. Its IUPAC name is 3-[2-[5-bromo-1-(2,2-dimethylpropanoyl)indol-3-yl]-2-cyanoethenyl]-4-methoxybenzonitrile.
| Compound Name | 3-[2-[5-bromo-1-(2,2-dimethylpropanoyl)indol-3-yl]-2-cyanoethenyl]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 123697082 |
| Molecular Formula | C24H20BrN3O2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 3-[2-[5-bromo-1-(2,2-dimethylpropanoyl)indol-3-yl]-2-cyanoethenyl]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1C=C(C#N)c1cn(C(=O)C(C)(C)C)c2ccc(Br)cc12 |
| InChI | InChI=1S/C24H20BrN3O2/c1-24(2,3)23(29)28-14-20(19-11-18(25)6-7-21(19)28)17(13-27)10-16-9-15(12-26)5-8-22(16)30-4/h5-11,14H,1-4H3 |
| InChIKey | DMUNBSATJIAANP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|