C23H18BrN3O5P+ — CID 170700857
3-[5-bromo-3-[(Z)-1-cyano-2-(5-cyano-2-methoxyphenyl)ethenyl]indole-1-carbonyl]oxypropyl-hydroxy-oxophosphanium (PubChem CID 170700857) has the molecular formula C23H18BrN3O5P+ and a molecular weight of 527.29 g/mol. Its IUPAC name is 3-[5-bromo-3-[(Z)-1-cyano-2-(5-cyano-2-methoxyphenyl)ethenyl]indole-1-carbonyl]oxypropyl-hydroxy-oxophosphanium.
| Compound Name | 3-[5-bromo-3-[(Z)-1-cyano-2-(5-cyano-2-methoxyphenyl)ethenyl]indole-1-carbonyl]oxypropyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 170700857 |
| Molecular Formula | C23H18BrN3O5P+ |
| Molecular Weight | 527.29 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 3-[5-bromo-3-[(Z)-1-cyano-2-(5-cyano-2-methoxyphenyl)ethenyl]indole-1-carbonyl]oxypropyl-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C#N)cc1/C=C(\C#N)c1cn(C(=O)OCCC[P+](=O)O)c2ccc(Br)cc12 |
| InChI | InChI=1S/C23H17BrN3O5P/c1-31-22-6-3-15(12-25)9-16(22)10-17(13-26)20-14-27(21-5-4-18(24)11-19(20)21)23(28)32-7-2-8-33(29)30/h3-6,9-11,14H,2,7-8H2,1H3/p+1/b17-10+ |
| InChIKey | WFJZFPYAICTWOS-LICLKQGHSA-O |
| XLogP | 5.46 |
| TPSA | 125.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|