C16H22BNO3 — CID 123298951
2,4,5-trideuterio-3-[4,4-dimethyl-5,5-bis(trideuteriomethyl)-1,3,2-dioxaborolan-2-yl]-6-propan-2-yloxybenzonitrile (PubChem CID 123298951) has the molecular formula C16H22BNO3 and a molecular weight of 296.22 g/mol. Its IUPAC name is 2,4,5-trideuterio-3-[4,4-dimethyl-5,5-bis(trideuteriomethyl)-1,3,2-dioxaborolan-2-yl]-6-propan-2-yloxybenzonitrile.
| Compound Name | 2,4,5-trideuterio-3-[4,4-dimethyl-5,5-bis(trideuteriomethyl)-1,3,2-dioxaborolan-2-yl]-6-propan-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 123298951 |
| Molecular Formula | C16H22BNO3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2,4,5-trideuterio-3-[4,4-dimethyl-5,5-bis(trideuteriomethyl)-1,3,2-dioxaborolan-2-yl]-6-propan-2-yloxybenzonitrile |
| SMILES | [2H]c1c([2H])c(B2OC(C)(C)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O2)c([2H])c(C#N)c1OC(C)C |
| InChI | InChI=1S/C16H22BNO3/c1-11(2)19-14-8-7-13(9-12(14)10-18)17-20-15(3,4)16(5,6)21-17/h7-9,11H,1-6H3/i3D3,4D3,7D,8D,9D |
| InChIKey | PVUYNFQZHNNZLT-GRYBGXQPSA-N |
| XLogP | 2.64 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|