C21H23BN4O3 — CID 164920671
4-[(1R)-1-pyridin-2-ylethoxy]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 164920671) has the molecular formula C21H23BN4O3 and a molecular weight of 390.25 g/mol. Its IUPAC name is 4-[(1R)-1-pyridin-2-ylethoxy]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 4-[(1R)-1-pyridin-2-ylethoxy]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164920671 |
| Molecular Formula | C21H23BN4O3 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[(1R)-1-pyridin-2-ylethoxy]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | C[C@@H](Oc1cc(B2OC(C)(C)C(C)(C)O2)cn2ncc(C#N)c12)c1ccccn1 |
| InChI | InChI=1S/C21H23BN4O3/c1-14(17-8-6-7-9-24-17)27-18-10-16(13-26-19(18)15(11-23)12-25-26)22-28-20(2,3)21(4,5)29-22/h6-10,12-14H,1-5H3/t14-/m1/s1 |
| InChIKey | WLENBTSEHLJVLZ-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 81.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|