C22H25BF3N3O3 — CID 178013557
7-[(1R)-1-pyridin-2-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazole (PubChem CID 178013557) has the molecular formula C22H25BF3N3O3 and a molecular weight of 447.27 g/mol. Its IUPAC name is 7-[(1R)-1-pyridin-2-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazole.
| Compound Name | 7-[(1R)-1-pyridin-2-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 178013557 |
| Molecular Formula | C22H25BF3N3O3 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 7-[(1R)-1-pyridin-2-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)benzimidazole |
| SMILES | C[C@@H](Oc1cc(B2OC(C)(C)C(C)(C)O2)cc2ncn(CC(F)(F)F)c12)c1ccccn1 |
| InChI | InChI=1S/C22H25BF3N3O3/c1-14(16-8-6-7-9-27-16)30-18-11-15(23-31-20(2,3)21(4,5)32-23)10-17-19(18)29(13-28-17)12-22(24,25)26/h6-11,13-14H,12H2,1-5H3/t14-/m1/s1 |
| InChIKey | LDEBHNJVINBWHF-CQSZACIVSA-N |
| XLogP | 4.43 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|