C19H24BFN2O3 — CID 164858821
3-[(1R)-1-(3-fluorophenyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 164858821) has the molecular formula C19H24BFN2O3 and a molecular weight of 358.22 g/mol. Its IUPAC name is 3-[(1R)-1-(3-fluorophenyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-[(1R)-1-(3-fluorophenyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 164858821 |
| Molecular Formula | C19H24BFN2O3 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-[(1R)-1-(3-fluorophenyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | C[C@@H](Oc1cc(B2OC(C)(C)C(C)(C)O2)cnc1N)c1cccc(F)c1 |
| InChI | InChI=1S/C19H24BFN2O3/c1-12(13-7-6-8-15(21)9-13)24-16-10-14(11-23-17(16)22)20-25-18(2,3)19(4,5)26-20/h6-12H,1-5H3,(H2,22,23)/t12-/m1/s1 |
| InChIKey | VGAHJESEWOJAGQ-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|