C16H15FN4O — CID 11529516
5-[1-(3-fluorophenyl)ethoxy]quinazoline-2,4-diamine (PubChem CID 11529516) has the molecular formula C16H15FN4O and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-[1-(3-fluorophenyl)ethoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[1-(3-fluorophenyl)ethoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 11529516 |
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[1-(3-fluorophenyl)ethoxy]quinazoline-2,4-diamine |
| SMILES | CC(Oc1cccc2nc(N)nc(N)c12)c1cccc(F)c1 |
| InChI | InChI=1S/C16H15FN4O/c1-9(10-4-2-5-11(17)8-10)22-13-7-3-6-12-14(13)15(18)21-16(19)20-12/h2-9H,1H3,(H4,18,19,20,21) |
| InChIKey | KMLKOKGGFHWWED-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |