C17H23BN4O3 — CID 164859707
3-[(1S)-1-pyrimidin-5-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 164859707) has the molecular formula C17H23BN4O3 and a molecular weight of 342.21 g/mol. Its IUPAC name is 3-[(1S)-1-pyrimidin-5-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-[(1S)-1-pyrimidin-5-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 164859707 |
| Molecular Formula | C17H23BN4O3 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[(1S)-1-pyrimidin-5-ylethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | C[C@H](Oc1cc(B2OC(C)(C)C(C)(C)O2)cnc1N)c1cncnc1 |
| InChI | InChI=1S/C17H23BN4O3/c1-11(12-7-20-10-21-8-12)23-14-6-13(9-22-15(14)19)18-24-16(2,3)17(4,5)25-18/h6-11H,1-5H3,(H2,19,22)/t11-/m0/s1 |
| InChIKey | MTRLSGXFDCGPQQ-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|