C22H31F2N3O3S — CID 123299900
5-(4-cyclopentylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 123299900) has the molecular formula C22H31F2N3O3S and a molecular weight of 455.57 g/mol. Its IUPAC name is 5-(4-cyclopentylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | 5-(4-cyclopentylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 123299900 |
| Molecular Formula | C22H31F2N3O3S |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 5-(4-cyclopentylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | NC1CC(N2CCC3C2CCN3S(=O)(=O)C2CCCC2)COC1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H31F2N3O3S/c23-14-5-6-18(24)17(11-14)22-19(25)12-15(13-30-22)26-9-7-21-20(26)8-10-27(21)31(28,29)16-3-1-2-4-16/h5-6,11,15-16,19-22H,1-4,7-10,12-13,25H2 |
| InChIKey | WUKCNGHMZXSQCB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |