C10H12N2O — CID 123300866
5-(2,4-dimethylphenyl)-2H-1,2,5-oxadiazole (PubChem CID 123300866) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-2H-1,2,5-oxadiazole.
| Compound Name | 5-(2,4-dimethylphenyl)-2H-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 123300866 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-2H-1,2,5-oxadiazole |
| SMILES | Cc1ccc(N2C=CNO2)c(C)c1 |
| InChI | InChI=1S/C10H12N2O/c1-8-3-4-10(9(2)7-8)12-6-5-11-13-12/h3-7,11H,1-2H3 |
| InChIKey | MDFVNDLNNSJEQE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |