C22H34N2O5 — CID 123300932
4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoic acid (PubChem CID 123300932) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoic acid.
| Compound Name | 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoic acid |
|---|---|
| PubChem CID | 123300932 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoic acid |
| SMILES | CCCC(NC(O)OC(C)(C)C)C(=O)NC(C=CC(=O)O)CCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O5/c1-5-9-18(24-21(28)29-22(2,3)4)20(27)23-17(14-15-19(25)26)13-12-16-10-7-6-8-11-16/h6-8,10-11,14-15,17-18,21,24,28H,5,9,12-13H2,1-4H3,(H,23,27)(H,25,26) |
| InChIKey | MZDYJFMRNCBIBQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|