C23H36N2O5 — CID 123342546
methyl 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoate (PubChem CID 123342546) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is methyl 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoate.
| Compound Name | methyl 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 123342546 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | methyl 4-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]pentanoylamino]-6-phenylhex-2-enoate |
| SMILES | CCCC(NC(O)OC(C)(C)C)C(=O)NC(C=CC(=O)OC)CCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O5/c1-6-10-19(25-22(28)30-23(2,3)4)21(27)24-18(15-16-20(26)29-5)14-13-17-11-8-7-9-12-17/h7-9,11-12,15-16,18-19,22,25,28H,6,10,13-14H2,1-5H3,(H,24,27) |
| InChIKey | WJBWSQSAEPASIP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|