C30H47N3O9S — CID 123301492
5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[2-[2-(2,5-diformylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 123301492) has the molecular formula C30H47N3O9S and a molecular weight of 625.79 g/mol. Its IUPAC name is 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[2-[2-(2,5-diformylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[2-[2-(2,5-diformylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 123301492 |
| Molecular Formula | C30H47N3O9S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[2-[2-(2,5-diformylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=Cc1ccc(C=O)c(OCCOCCOCCOCCOCCOCCNC(=O)CCCCC2SCC3NCNC32)c1 |
| InChI | InChI=1S/C30H47N3O9S/c34-20-24-5-6-25(21-35)27(19-24)42-18-17-41-16-15-40-14-13-39-12-11-38-10-9-37-8-7-31-29(36)4-2-1-3-28-30-26(22-43-28)32-23-33-30/h5-6,19-21,26,28,30,32-33H,1-4,7-18,22-23H2,(H,31,36) |
| InChIKey | GJVNEHLWKXEJCS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|