C22H32N4O8S — CID 163911695
N-[2-[2-(4-formyl-2-methoxy-6-nitrophenoxy)ethoxy]ethyl]-5-(3-oxido-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-3-ium-4-yl)pentanamide (PubChem CID 163911695) has the molecular formula C22H32N4O8S and a molecular weight of 512.59 g/mol. Its IUPAC name is N-[2-[2-(4-formyl-2-methoxy-6-nitrophenoxy)ethoxy]ethyl]-5-(3-oxido-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-3-ium-4-yl)pentanamide.
| Compound Name | N-[2-[2-(4-formyl-2-methoxy-6-nitrophenoxy)ethoxy]ethyl]-5-(3-oxido-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-3-ium-4-yl)pentanamide |
|---|---|
| PubChem CID | 163911695 |
| Molecular Formula | C22H32N4O8S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | N-[2-[2-(4-formyl-2-methoxy-6-nitrophenoxy)ethoxy]ethyl]-5-(3-oxido-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-3-ium-4-yl)pentanamide |
| SMILES | COc1cc(C=O)cc([N+](=O)[O-])c1OCCOCCNC(=O)CCCCC1SCC2NC[NH+]([O-])C21 |
| InChI | InChI=1S/C22H32N4O8S/c1-32-18-11-15(12-27)10-17(26(30)31)22(18)34-9-8-33-7-6-23-20(28)5-3-2-4-19-21-16(13-35-19)24-14-25(21)29/h10-12,16,19,21,24-25H,2-9,13-14H2,1H3,(H,23,28) |
| InChIKey | QSRCQOUITRUKEH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|