C18H23N3O9S — CID 123501135
5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(2,5-diformylphenyl)peroxyperoxyperoxypentanamide (PubChem CID 123501135) has the molecular formula C18H23N3O9S and a molecular weight of 457.46 g/mol. Its IUPAC name is 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(2,5-diformylphenyl)peroxyperoxyperoxypentanamide.
| Compound Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(2,5-diformylphenyl)peroxyperoxyperoxypentanamide |
|---|---|
| PubChem CID | 123501135 |
| Molecular Formula | C18H23N3O9S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 5-(2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl)-N-(2,5-diformylphenyl)peroxyperoxyperoxypentanamide |
| SMILES | O=Cc1ccc(C=O)c(OOOOOONC(=O)CCCCC2SCC3NCNC32)c1 |
| InChI | InChI=1S/C18H23N3O9S/c22-8-12-5-6-13(9-23)15(7-12)25-27-29-30-28-26-21-17(24)4-2-1-3-16-18-14(10-31-16)19-11-20-18/h5-9,14,16,18-20H,1-4,10-11H2,(H,21,24) |
| InChIKey | XABZRLZMAHAPCG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|