C31H47N3O8S — CID 58481224
2-amino-4-[2-oxo-6-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]hexoxy]benzaldehyde (PubChem CID 58481224) has the molecular formula C31H47N3O8S and a molecular weight of 621.80 g/mol. Its IUPAC name is 2-amino-4-[2-oxo-6-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]hexoxy]benzaldehyde.
| Compound Name | 2-amino-4-[2-oxo-6-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]hexoxy]benzaldehyde |
|---|---|
| PubChem CID | 58481224 |
| Molecular Formula | C31H47N3O8S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 2-amino-4-[2-oxo-6-[2-[2-[5-oxo-9-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)nonoxy]ethoxy]ethoxy]hexoxy]benzaldehyde |
| SMILES | Nc1cc(OCC(=O)CCCCOCCOCCOCCCCC(=O)CCCCC2SCC3NC(=O)NC32)ccc1C=O |
| InChI | InChI=1S/C31H47N3O8S/c32-27-19-26(12-11-23(27)20-35)42-21-25(37)9-4-6-14-40-16-18-41-17-15-39-13-5-3-8-24(36)7-1-2-10-29-30-28(22-43-29)33-31(38)34-30/h11-12,19-20,28-30H,1-10,13-18,21-22,32H2,(H2,33,34,38) |
| InChIKey | HKLQRERWOSQBGB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|