C29H48N4O6S — CID 161154326
4-[9-[2-[2-(6-amino-5-oxo-7-pyrrol-1-ylheptoxy)ethoxy]ethoxy]-5-oxononyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 161154326) has the molecular formula C29H48N4O6S and a molecular weight of 580.79 g/mol. Its IUPAC name is 4-[9-[2-[2-(6-amino-5-oxo-7-pyrrol-1-ylheptoxy)ethoxy]ethoxy]-5-oxononyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | 4-[9-[2-[2-(6-amino-5-oxo-7-pyrrol-1-ylheptoxy)ethoxy]ethoxy]-5-oxononyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 161154326 |
| Molecular Formula | C29H48N4O6S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | 4-[9-[2-[2-(6-amino-5-oxo-7-pyrrol-1-ylheptoxy)ethoxy]ethoxy]-5-oxononyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | NC(Cn1cccc1)C(=O)CCCCOCCOCCOCCCCC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C29H48N4O6S/c30-24(21-33-13-5-6-14-33)26(35)11-4-8-16-38-18-20-39-19-17-37-15-7-3-10-23(34)9-1-2-12-27-28-25(22-40-27)31-29(36)32-28/h5-6,13-14,24-25,27-28H,1-4,7-12,15-22,30H2,(H2,31,32,36) |
| InChIKey | IJLLLJTWCMHXGU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|