C32H60N6O4S — CID 159511362
6-[5-[(3aS,4S,6aR)-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-[2-[[2-[[(3R)-2,2,3,6,6-pentamethylheptan-4-ylidene]amino]oxyacetyl]amino]ethyl]hexanamide (PubChem CID 159511362) has the molecular formula C32H60N6O4S and a molecular weight of 624.94 g/mol. Its IUPAC name is 6-[5-[(3aS,4S,6aR)-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-[2-[[2-[[(3R)-2,2,3,6,6-pentamethylheptan-4-ylidene]amino]oxyacetyl]amino]ethyl]hexanamide.
| Compound Name | 6-[5-[(3aS,4S,6aR)-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-[2-[[2-[[(3R)-2,2,3,6,6-pentamethylheptan-4-ylidene]amino]oxyacetyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 159511362 |
| Molecular Formula | C32H60N6O4S |
| Molecular Weight | 624.94 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | 6-[5-[(3aS,4S,6aR)-2,3,3a,4,6,6a-hexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoylamino]-N-[2-[[2-[[(3R)-2,2,3,6,6-pentamethylheptan-4-ylidene]amino]oxyacetyl]amino]ethyl]hexanamide |
| SMILES | C[C@@H](C(CC(C)(C)C)=NOCC(=O)NCCNC(=O)CCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NCN[C@@H]21)C(C)(C)C |
| InChI | InChI=1S/C32H60N6O4S/c1-23(32(5,6)7)24(19-31(2,3)4)38-42-20-29(41)35-18-17-34-28(40)14-9-8-12-16-33-27(39)15-11-10-13-26-30-25(21-43-26)36-22-37-30/h23,25-26,30,36-37H,8-22H2,1-7H3,(H,33,39)(H,34,40)(H,35,41)/t23-,25-,26-,30-/m0/s1 |
| InChIKey | MAQIONULALHEMY-UJOCQTKCSA-N |
| XLogP | 3.95 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|