C18H18N2O3S — CID 123302572
2-(3-methoxy-4-methylphenyl)-6-methylsulfonylquinolin-4-amine (PubChem CID 123302572) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylphenyl)-6-methylsulfonylquinolin-4-amine.
| Compound Name | 2-(3-methoxy-4-methylphenyl)-6-methylsulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 123302572 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(3-methoxy-4-methylphenyl)-6-methylsulfonylquinolin-4-amine |
| SMILES | COc1cc(-c2cc(N)c3cc(S(C)(=O)=O)ccc3n2)ccc1C |
| InChI | InChI=1S/C18H18N2O3S/c1-11-4-5-12(8-18(11)23-2)17-10-15(19)14-9-13(24(3,21)22)6-7-16(14)20-17/h4-10H,1-3H3,(H2,19,20) |
| InChIKey | WHOPUDJZBWPTKW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |