C28H28N2O4 — CID 123307237
methyl 2-[1-methyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoate (PubChem CID 123307237) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl 2-[1-methyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoate.
| Compound Name | methyl 2-[1-methyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoate |
|---|---|
| PubChem CID | 123307237 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | methyl 2-[1-methyl-5-[4-[(4-methylbenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]butanoate |
| SMILES | CCC(C(=O)OC)N1C(=O)c2cc(-c3ccc(NC(=O)c4ccc(C)cc4)cc3)ccc2C1C |
| InChI | InChI=1S/C28H28N2O4/c1-5-25(28(33)34-4)30-18(3)23-15-12-21(16-24(23)27(30)32)19-10-13-22(14-11-19)29-26(31)20-8-6-17(2)7-9-20/h6-16,18,25H,5H2,1-4H3,(H,29,31) |
| InChIKey | BKHYWNPDTOYQGW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |