C24H13Cl2F6NO2S — CID 123307797
[2-[2,4-bis(trifluoromethyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]methanediol (PubChem CID 123307797) has the molecular formula C24H13Cl2F6NO2S and a molecular weight of 564.33 g/mol. Its IUPAC name is [2-[2,4-bis(trifluoromethyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]methanediol.
| Compound Name | [2-[2,4-bis(trifluoromethyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 123307797 |
| Molecular Formula | C24H13Cl2F6NO2S |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 562.99 |
| IUPAC Name | [2-[2,4-bis(trifluoromethyl)phenyl]-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]methanediol |
| SMILES | OC(O)c1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)ccc1-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H13Cl2F6NO2S/c25-18-6-2-11(8-19(18)26)20-10-36-21(33-20)12-1-4-14(16(7-12)22(34)35)15-5-3-13(23(27,28)29)9-17(15)24(30,31)32/h1-10,22,34-35H |
| InChIKey | PXWHSZVJDWBCGY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|