C23H12Cl2F3N2O4S- — CID 163660714
[2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-4-(trifluoromethyl)phenyl]-dioxidoazanium (PubChem CID 163660714) has the molecular formula C23H12Cl2F3N2O4S- and a molecular weight of 540.33 g/mol. Its IUPAC name is [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-4-(trifluoromethyl)phenyl]-dioxidoazanium.
| Compound Name | [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-4-(trifluoromethyl)phenyl]-dioxidoazanium |
|---|---|
| PubChem CID | 163660714 |
| Molecular Formula | C23H12Cl2F3N2O4S- |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [2-[2-carboxy-4-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl]-4-(trifluoromethyl)phenyl]-dioxidoazanium |
| SMILES | O=C(O)c1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)ccc1-c1cc(C(F)(F)F)ccc1[NH+]([O-])[O-] |
| InChI | InChI=1S/C23H12Cl2F3N2O4S/c24-17-5-2-11(8-18(17)25)19-10-35-21(29-19)12-1-4-14(16(7-12)22(31)32)15-9-13(23(26,27)28)3-6-20(15)30(33)34/h1-10,30H,(H,31,32)/q-1 |
| InChIKey | IUDOUFNFSLFWQI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|