C22H15Cl3FNO2S — CID 123316566
2-(2-chloro-4-fluorohexa-2,4-dien-3-yl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 123316566) has the molecular formula C22H15Cl3FNO2S and a molecular weight of 482.79 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorohexa-2,4-dien-3-yl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 2-(2-chloro-4-fluorohexa-2,4-dien-3-yl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123316566 |
| Molecular Formula | C22H15Cl3FNO2S |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 2-(2-chloro-4-fluorohexa-2,4-dien-3-yl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]benzoic acid |
| SMILES | CC=C(F)C(=C(C)Cl)c1ccc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)cc1C(=O)O |
| InChI | InChI=1S/C22H15Cl3FNO2S/c1-3-18(26)20(11(2)23)14-6-4-13(8-15(14)22(28)29)21-27-19(10-30-21)12-5-7-16(24)17(25)9-12/h3-10H,1-2H3,(H,28,29) |
| InChIKey | OVAIYQICUNDEED-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|