C8H9NO — CID 123308779
2-methyl-4,5-dihydro-1,3-benzoxazole (PubChem CID 123308779) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-1,3-benzoxazole.
| Compound Name | 2-methyl-4,5-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 123308779 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-methyl-4,5-dihydro-1,3-benzoxazole |
| SMILES | Cc1nc2c(o1)C=CCC2 |
| InChI | InChI=1S/C8H9NO/c1-6-9-7-4-2-3-5-8(7)10-6/h3,5H,2,4H2,1H3 |
| InChIKey | MKFIMDGLJOUPDZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |