C10H21NS — CID 123309568
4,7-dimethyl-7-propan-2-yl-1,4-thiazepane (PubChem CID 123309568) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is 4,7-dimethyl-7-propan-2-yl-1,4-thiazepane.
| Compound Name | 4,7-dimethyl-7-propan-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 123309568 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4,7-dimethyl-7-propan-2-yl-1,4-thiazepane |
| SMILES | CC(C)C1(C)CCN(C)CCS1 |
| InChI | InChI=1S/C10H21NS/c1-9(2)10(3)5-6-11(4)7-8-12-10/h9H,5-8H2,1-4H3 |
| InChIKey | AHWMOBDSWJJMHA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |