C14H29NS — CID 123975479
2,4,6-triethyl-3,5,7-trimethyl-1,3-thiazepane (PubChem CID 123975479) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is 2,4,6-triethyl-3,5,7-trimethyl-1,3-thiazepane.
| Compound Name | 2,4,6-triethyl-3,5,7-trimethyl-1,3-thiazepane |
|---|---|
| PubChem CID | 123975479 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2,4,6-triethyl-3,5,7-trimethyl-1,3-thiazepane |
| SMILES | CCC1C(C)SC(CC)N(C)C(CC)C1C |
| InChI | InChI=1S/C14H29NS/c1-7-12-10(4)13(8-2)15(6)14(9-3)16-11(12)5/h10-14H,7-9H2,1-6H3 |
| InChIKey | WDPCPOLMZIJKRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |