C14H16F2OS — CID 123309776
1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-one (PubChem CID 123309776) has the molecular formula C14H16F2OS and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-one.
| Compound Name | 1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-one |
|---|---|
| PubChem CID | 123309776 |
| Molecular Formula | C14H16F2OS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-one |
| SMILES | C=CCCCC(=O)c1ccc(SC(C)(F)F)cc1 |
| InChI | InChI=1S/C14H16F2OS/c1-3-4-5-6-13(17)11-7-9-12(10-8-11)18-14(2,15)16/h3,7-10H,1,4-6H2,2H3 |
| InChIKey | FFTCIKDDBUQNBR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|