C14H18F2OS — CID 134408158
(1S)-1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-ol (PubChem CID 134408158) has the molecular formula C14H18F2OS and a molecular weight of 272.36 g/mol. Its IUPAC name is (1S)-1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-ol.
| Compound Name | (1S)-1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-ol |
|---|---|
| PubChem CID | 134408158 |
| Molecular Formula | C14H18F2OS |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1S)-1-[4-(1,1-difluoroethylsulfanyl)phenyl]hex-5-en-1-ol |
| SMILES | C=CCCC[C@H](O)c1ccc(SC(C)(F)F)cc1 |
| InChI | InChI=1S/C14H18F2OS/c1-3-4-5-6-13(17)11-7-9-12(10-8-11)18-14(2,15)16/h3,7-10,13,17H,1,4-6H2,2H3/t13-/m0/s1 |
| InChIKey | GZVWLIIWEXBHQQ-ZDUSSCGKSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|