C21H25NO2 — CID 123310373
(1R,2S,7R,10S,11R)-17-formyl-7-methyl-14-oxopentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-ene-13-carbonitrile (PubChem CID 123310373) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R,2S,7R,10S,11R)-17-formyl-7-methyl-14-oxopentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-ene-13-carbonitrile.
| Compound Name | (1R,2S,7R,10S,11R)-17-formyl-7-methyl-14-oxopentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-ene-13-carbonitrile |
|---|---|
| PubChem CID | 123310373 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1R,2S,7R,10S,11R)-17-formyl-7-methyl-14-oxopentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-ene-13-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(C=O)C4=CC(=O)C(C#N)C[C@@H]43)[C@@H]1CC1CC12 |
| InChI | InChI=1S/C21H25NO2/c1-21-3-2-14-16-4-12(9-22)20(24)8-15(16)13(10-23)5-17(14)19(21)7-11-6-18(11)21/h8,10-14,16-19H,2-7H2,1H3/t11?,12?,13?,14-,16-,17-,18?,19+,21-/m1/s1 |
| InChIKey | BAELZSHJCRPFJE-ZWPTVVTNSA-N |
| XLogP | 3.55 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|