C19H25NO — CID 67979700
(8R,9S,10R,13S,14S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile (PubChem CID 67979700) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 67979700 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C(C#N)C[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C19H25NO/c1-19-7-2-3-17(19)15-5-4-12-10-18(21)13(11-20)9-16(12)14(15)6-8-19/h10,13-17H,2-9H2,1H3/t13?,14-,15+,16-,17-,19-/m0/s1 |
| InChIKey | XLYQGGHQLAVORB-AUYUWOROSA-N |
| XLogP | 4.27 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|