C17H26O — CID 173156253
(3aS,3bR,9aR,9bS,11aS)-11a-methyl-2,3,3a,3b,4,5,8,9,9a,9b,10,11-dodecahydro-1H-indeno[5,4-f]isochromene (PubChem CID 173156253) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bS,11aS)-11a-methyl-2,3,3a,3b,4,5,8,9,9a,9b,10,11-dodecahydro-1H-indeno[5,4-f]isochromene.
| Compound Name | (3aS,3bR,9aR,9bS,11aS)-11a-methyl-2,3,3a,3b,4,5,8,9,9a,9b,10,11-dodecahydro-1H-indeno[5,4-f]isochromene |
|---|---|
| PubChem CID | 173156253 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3aS,3bR,9aR,9bS,11aS)-11a-methyl-2,3,3a,3b,4,5,8,9,9a,9b,10,11-dodecahydro-1H-indeno[5,4-f]isochromene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=COCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C17H26O/c1-17-8-2-3-16(17)15-5-4-12-11-18-10-7-13(12)14(15)6-9-17/h11,13-16H,2-10H2,1H3/t13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | WVXBNPIYMRWQRR-BIVLZKPYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |