C25H33NO — CID 123172861
(7S,8R,9S,10R,13S,14S,17R)-7-cyclopropyl-17-ethyl-13-methyl-16-methylidene-3-oxo-1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonitrile (PubChem CID 123172861) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17R)-7-cyclopropyl-17-ethyl-13-methyl-16-methylidene-3-oxo-1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonitrile.
| Compound Name | (7S,8R,9S,10R,13S,14S,17R)-7-cyclopropyl-17-ethyl-13-methyl-16-methylidene-3-oxo-1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 123172861 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17R)-7-cyclopropyl-17-ethyl-13-methyl-16-methylidene-3-oxo-1,2,6,7,8,9,10,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-2-carbonitrile |
| SMILES | C=C1C[C@H]2[C@H]3[C@H](CC[C@]2(C)[C@@H]1CC)[C@H]1CC(C#N)C(=O)C=C1C[C@H]3C1CC1 |
| InChI | InChI=1S/C25H33NO/c1-4-21-14(2)9-22-24-18(7-8-25(21,22)3)19-11-17(13-26)23(27)12-16(19)10-20(24)15-5-6-15/h12,15,17-22,24H,2,4-11H2,1,3H3/t17?,18-,19+,20+,21-,22+,24+,25-/m1/s1 |
| InChIKey | JMZNBCDIMHIEOS-NWXBCOSWSA-N |
| XLogP | 5.71 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|