C23H31NO — CID 91468791
(7S,8R,9S,10R,13S,14S,17S)-17-ethyl-7,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 91468791) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (7S,8R,9S,10R,13S,14S,17S)-17-ethyl-7,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (7S,8R,9S,10R,13S,14S,17S)-17-ethyl-7,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 91468791 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (7S,8R,9S,10R,13S,14S,17S)-17-ethyl-7,13-dimethyl-2-methylidene-3-oxo-6,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=C1C[C@H]2C(=CC1=O)C[C@H](C)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C#N)CC |
| InChI | InChI=1S/C23H31NO/c1-5-23(13-24)9-7-19-21-15(3)10-16-12-20(25)14(2)11-18(16)17(21)6-8-22(19,23)4/h12,15,17-19,21H,2,5-11H2,1,3-4H3/t15-,17+,18-,19-,21+,22-,23+/m0/s1 |
| InChIKey | XHMCKKHVIACILR-LBGSCMJESA-N |
| XLogP | 5.46 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|